cas: 2472-22-2 — see every product listed under this CAS number, including other names
6-Methoxy-3,4-dihydronaphthalen-2(1H)-one 98% (CAS 2472-22-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A394517-100mg |
| cas | 2472-22-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1321.56 Pln | |
| Ambeed | 25g | 4542.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A394517 |
6-methoxy-3,4-dihydro-1H-naphthalen-2-one (CAS 2472-22-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-1H-naphthalen-2-one. InChIKey: RMRKDYNVZWKAFP-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | RMRKDYNVZWKAFP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)CC2)C=C1 |
Computed by PubChem (NCBI)