cas: 2472-22-2 — see every product listed under this CAS number, including other names
6-Methoxy-3,4-dihydronaphthalen-2(1H)-one (CAS 2472-22-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F069098-100MG |
| cas | 2472-22-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 1815.00 Pln | |
| Fluorochem | 25g | 7599.43 Pln |
| delivery time | 3-4 weeks |
|---|
6-methoxy-3,4-dihydro-1H-naphthalen-2-one (CAS 2472-22-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-1H-naphthalen-2-one. InChIKey: RMRKDYNVZWKAFP-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | RMRKDYNVZWKAFP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)CC2)C=C1 |
Computed by PubChem (NCBI)