6-Nitroquinoxaline, 97%, 97%
cas: 6639-87-8 — see every product listed under this CAS number, including other names
6-Nitroquinoxaline, 97%, 97% (CAS 6639-87-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NBK-100mg |
| cas | 6639-87-8 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 309.20 Pln | |
| Chemat | 100g | 750.80 Pln | |
| Chemat | 50g | 477.20 Pln | |
| Chemat | 250g | 1442.00 Pln | |
| Chemat | 500g | 2544.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-nitroquinoxaline (CAS 6639-87-8) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: 6-nitroquinoxaline. InChIKey: YLKFDRWBZAALPN-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 6-nitroquinoxaline |
| InChIKey | YLKFDRWBZAALPN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN=C2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)