CAS 2847895-23-0 is the registry number for 4-Oxo-3,4-dihydropyrido[3,2-d]pyrimidine-7-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-3H-pyrido[3,2-d]pyrimidine-7-carbaldehyde (CAS 2847895-23-0) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: 4-oxo-3H-pyrido[3,2-d]pyrimidine-7-carbaldehyde. InChIKey: RUIWABCVFMTLEP-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 4-oxo-3H-pyrido[3,2-d]pyrimidine-7-carbaldehyde |
| InChIKey | RUIWABCVFMTLEP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CNC2=O)C=O |
Computed by PubChem (NCBI)