CAS 120493-12-1 is the registry number for 6-Nitrophthalazine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-nitrophthalazine (CAS 120493-12-1) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: 6-nitrophthalazine. InChIKey: GVLAWBPLKDRQCZ-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 6-nitrophthalazine |
| InChIKey | GVLAWBPLKDRQCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=NC=C2C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)