CAS 89898-86-2 appears in our catalog under these names: 5-Nitrophthalazine 95%, 5-Nitrophthalazine, 95%, 95%, 5-Nitrophthalazine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-nitrophthalazine (CAS 89898-86-2) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: 5-nitrophthalazine. InChIKey: NWASGBYNFZVASN-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 5-nitrophthalazine |
| InChIKey | NWASGBYNFZVASN-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=NC=C2C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)