CAS 1023815-46-4 is the registry number for Pyrido[3,4-b]pyrazine-8-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Pyrido[3,4-b]pyrazine-8-carboxylic acid (CAS 1023815-46-4) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: pyrido[3,4-b]pyrazine-8-carboxylic acid. InChIKey: ATMVCZNUYYSYSO-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | pyrido[3,4-b]pyrazine-8-carboxylic acid |
| InChIKey | ATMVCZNUYYSYSO-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=CN=CC2=N1)C(=O)O |
Computed by PubChem (NCBI)