Products 1023815-46-4

CAS 1023815-46-4 is the registry number for Pyrido[3,4-b]pyrazine-8-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Pyrido[3,4-b]pyrazine-8-carboxylic acid (CAS 1023815-46-4) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: pyrido[3,4-b]pyrazine-8-carboxylic acid. InChIKey: ATMVCZNUYYSYSO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5N3O2
Molecular weight175.14 g/mol
IUPAC namepyrido[3,4-b]pyrazine-8-carboxylic acid
InChIKeyATMVCZNUYYSYSO-UHFFFAOYSA-N
SMILESC1=CN=C2C(=CN=CC2=N1)C(=O)O

Computed by PubChem (NCBI)