CAS 893723-33-6 appears in our catalog under these names: Pyrido(2,3-b)pyrazine-6-carboxylic acid, Pyrido(2,3-b)pyrazine-6-carboxylic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 10g, 5g.
Pyrido[2,3-b]pyrazine-6-carboxylic acid (CAS 893723-33-6) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: pyrido[2,3-b]pyrazine-6-carboxylic acid. InChIKey: HOBUKUYGYYLBAA-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | pyrido[2,3-b]pyrazine-6-carboxylic acid |
| InChIKey | HOBUKUYGYYLBAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=CN=C21)C(=O)O |
Computed by PubChem (NCBI)