CAS 4233-33-4 appears in our catalog under these names: 4-Phenyl-1,2,4-triazoline-3,5-dione, 4–Phenyl–1,2,4–triazoline–3,5–dione , 4-Phenyl-1,2,3-triazoline-3,5-dione, 4-PHENYL-1,2,4-TRIAZOLINE-3,5-DIONE, 97%, PTAD 95%. Offered by: TRC, GLPBio, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 1g, 500mg, 5g, 100mg, 10g, 25g, 50g, 100g.
4-phenyl-1,2,4-triazole-3,5-dione (CAS 4233-33-4) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: 4-phenyl-1,2,4-triazole-3,5-dione. InChIKey: ISULLEUFOQSBGY-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 4-phenyl-1,2,4-triazole-3,5-dione |
| InChIKey | ISULLEUFOQSBGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)N=NC2=O |
Computed by PubChem (NCBI)