Products 64241-51-6
CAS 64241-51-6 appears in our catalog under these names: Benzo(e)(1,2,4)triazine-3-carboxylic acid, 98%, 1,2,4-Benzotriazine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
1,2,4-benzotriazine-3-carboxylic acid (CAS 64241-51-6) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: 1,2,4-benzotriazine-3-carboxylic acid. InChIKey: LTYYZEOFAKPJGC-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 1,2,4-benzotriazine-3-carboxylic acid |
| InChIKey | LTYYZEOFAKPJGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)