CAS 1260808-64-7 is the registry number for 2-Oxo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-1H-pyrido[2,3-b][1,4]oxazine-7-carbonitrile (CAS 1260808-64-7) is a chemical compound with the molecular formula C8H5N3O2 and a molecular weight of 175.14 g/mol. IUPAC name: 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-7-carbonitrile. InChIKey: RFKVMRMJLWXEGJ-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2 |
|---|---|
| Molecular weight | 175.14 g/mol |
| IUPAC name | 2-oxo-1H-pyrido[2,3-b][1,4]oxazine-7-carbonitrile |
| InChIKey | RFKVMRMJLWXEGJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)N=CC(=C2)C#N |
Computed by PubChem (NCBI)