cas: 6374-90-9 — see every product listed under this CAS number, including other names
6-chloro-7-methyl-1H-indole-2,3-dione, 97% (CAS 6374-90-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F365555-100MG |
| cas | 6374-90-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 500mg | 768.50 Pln | |
| Fluorochem | 1g | 950.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-chloro-7-methyl-1H-indole-2,3-dione (CAS 6374-90-9) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-7-methyl-1H-indole-2,3-dione. InChIKey: SFWRUGVSPIELCW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-7-methyl-1H-indole-2,3-dione |
| InChIKey | SFWRUGVSPIELCW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)C2=O)Cl |
Computed by PubChem (NCBI)