cas: 61948-70-7 — see every product listed under this CAS number, including other names
7,8-Dimethoxyquinazoline-2,4(1H,3H)-dione, 95+% (CAS 61948-70-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A262719-1g |
| cas | 61948-70-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7009.66 Pln | |
| AmBeed | 5g | 20888.98 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
7,8-dimethoxy-1H-quinazoline-2,4-dione (CAS 61948-70-7) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 7,8-dimethoxy-1H-quinazoline-2,4-dione. InChIKey: ZNCZFFBFTRODRN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 7,8-dimethoxy-1H-quinazoline-2,4-dione |
| InChIKey | ZNCZFFBFTRODRN-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=O)NC(=O)N2)OC |
Computed by PubChem (NCBI)