CAS 188874-61-5 appears in our catalog under these names: 7-(Bromomethyl)quinoline hydrobromide, 95%, 7-Bromomethylquinoline Hydrobromide. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 100mg.
7-(bromomethyl)quinoline;hydrobromide (CAS 188874-61-5) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 7-(bromomethyl)quinoline;hydrobromide. InChIKey: ZZBJLKLNROHUFU-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 7-(bromomethyl)quinoline;hydrobromide |
| InChIKey | ZZBJLKLNROHUFU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)CBr)N=C1.Br |
Computed by PubChem (NCBI)