CAS 213337-42-9 is the registry number for 2-(Bromomethyl)quinoline hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(bromomethyl)quinoline;hydrobromide (CAS 213337-42-9) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 2-(bromomethyl)quinoline;hydrobromide. InChIKey: RMCAMMGJTSBUMO-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 2-(bromomethyl)quinoline;hydrobromide |
| InChIKey | RMCAMMGJTSBUMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)CBr.Br |
Computed by PubChem (NCBI)