CAS 1215541-16-4 is the registry number for 8-(Bromomethyl)isoquinoline hydrobromide, 97%. Offered by: AmBeed. Available pack sizes: 1g, 50mg.
8-(bromomethyl)isoquinoline;hydrobromide (CAS 1215541-16-4) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 8-(bromomethyl)isoquinoline;hydrobromide. InChIKey: XJXWIHGLONBFLI-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 8-(bromomethyl)isoquinoline;hydrobromide |
| InChIKey | XJXWIHGLONBFLI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2)C(=C1)CBr.Br |
Computed by PubChem (NCBI)