CAS 73870-28-7 appears in our catalog under these names: 4-(Bromomethyl)quinoline hydrobromide, 95%, 4-(Bromomethyl)quinoline hydrobromide, 98%, 4-(Bromomethyl)quinoline hydrobromide, 4-(Bromomethyl)quinoline hydrobromide, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 2,5g, 5g, 100mg, 2.5g.
4-(bromomethyl)quinoline;hydrobromide (CAS 73870-28-7) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 4-(bromomethyl)quinoline;hydrobromide. InChIKey: ODGKVBQETYSINO-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 4-(bromomethyl)quinoline;hydrobromide |
| InChIKey | ODGKVBQETYSINO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)CBr.Br |
Computed by PubChem (NCBI)