CAS 103030-25-7 appears in our catalog under these names: 6-(Bromomethyl)quinoline hydrobromide, 97%, 6-(Bromomethyl)quinoline hydrobromide 97%, 6-(Bromomethyl)quinoline hydrobromide, 97%, 97%, 6-(Bromomethyl)quinoline hydrobromide, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
6-(bromomethyl)quinoline;hydrobromide (CAS 103030-25-7) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 6-(bromomethyl)quinoline;hydrobromide. InChIKey: NPRSKVXFAHDCPT-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 6-(bromomethyl)quinoline;hydrobromide |
| InChIKey | NPRSKVXFAHDCPT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CBr)N=C1.Br |
Computed by PubChem (NCBI)