CAS 188861-57-6 appears in our catalog under these names: 6-(Bromomethyl)isoquinoline HBr, 96%, 6-(Bromomethyl)isoquinoline hydrobromide, 95%, 6-(Bromomethyl)isoquinoline hydrobromide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
6-(bromomethyl)isoquinoline;hydrobromide (CAS 188861-57-6) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 6-(bromomethyl)isoquinoline;hydrobromide. InChIKey: UVADKWYZZBPGTB-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 6-(bromomethyl)isoquinoline;hydrobromide |
| InChIKey | UVADKWYZZBPGTB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C=C1CBr.Br |
Computed by PubChem (NCBI)