CAS 337508-56-2 appears in our catalog under these names: 1–(Bromomethyl)isoquinoline hydrobromide, 1-(Bromomethyl)isoquinoline hydrobromide, 97% , 1-(Bromomethyl)isoquinoline hydrobromide 95%, 1-(Bromomethyl)isoquinoline hydrobromide, 97%. Offered by: GLPBio, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
1-(bromomethyl)isoquinoline;hydrobromide (CAS 337508-56-2) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 1-(bromomethyl)isoquinoline;hydrobromide. InChIKey: RWSWRJTWPXSENX-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 1-(bromomethyl)isoquinoline;hydrobromide |
| InChIKey | RWSWRJTWPXSENX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2CBr.Br |
Computed by PubChem (NCBI)