Products 1192352-34-3
CAS 1192352-34-3 appears in our catalog under these names: 3–(Bromomethyl)quinoline hydrobromide, 3-(Bromomethyl)quinoline hydrobromide, 3-(Bromomethyl)quinoline hydrobromide 95%, 3-(BROMOMETHYL)QUINOLINE HYDROBROMIDE, 95%, 3-(Bromomethyl)quinoline hydrobromide, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 5g, 100mg, 250mg, 1g.
3-(bromomethyl)quinoline;hydrobromide (CAS 1192352-34-3) is a chemical compound with the molecular formula C10H9Br2N and a molecular weight of 302.99 g/mol. IUPAC name: 3-(bromomethyl)quinoline;hydrobromide. InChIKey: CSCMSGZQBZXJNN-UHFFFAOYSA-N.
| Molecular formula | C10H9Br2N |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | 3-(bromomethyl)quinoline;hydrobromide |
| InChIKey | CSCMSGZQBZXJNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)CBr.Br |
Computed by PubChem (NCBI)