cas: 223671-13-4 — see every product listed under this CAS number, including other names
7-BROMO-1,4-DICHLOROISOQUINOLINE, 95% (CAS 223671-13-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F389986-100MG |
| cas | 223671-13-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 726.85 Pln | |
| Fluorochem | 250mg | 1013.20 Pln | |
| Fluorochem | 1g | 2434.58 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-1,4-dichloroisoquinoline (CAS 223671-13-4) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-1,4-dichloroisoquinoline. InChIKey: KWXXBZNOKYQKAI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-1,4-dichloroisoquinoline |
| InChIKey | KWXXBZNOKYQKAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)