cas: 223671-13-4 — see every product listed under this CAS number, including other names
7-Bromo-1,4-dichloroisoquinoline, 97%, 97% (CAS 223671-13-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5EY-100mg |
| cas | 223671-13-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5574.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1,4-dichloroisoquinoline (CAS 223671-13-4) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-1,4-dichloroisoquinoline. InChIKey: KWXXBZNOKYQKAI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-1,4-dichloroisoquinoline |
| InChIKey | KWXXBZNOKYQKAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)