cas: 924271-40-9 — see every product listed under this CAS number, including other names
7-Bromo-1,3-dichloroisoquinoline 97% (CAS 924271-40-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A291702-100g |
| cas | 924271-40-9 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 13731.50 Pln | |
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 876.56 Pln | |
| Ambeed | 25g | 3685.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A291702 |
7-bromo-1,3-dichloroisoquinoline (CAS 924271-40-9) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-1,3-dichloroisoquinoline. InChIKey: DVPABFNTLVFBQI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-1,3-dichloroisoquinoline |
| InChIKey | DVPABFNTLVFBQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(N=C(C=C21)Cl)Cl)Br |
Computed by PubChem (NCBI)