cas: 59820-91-6 — see every product listed under this CAS number, including other names
7-Bromo-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid, 97%, 97% (CAS 59820-91-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EC3U-100mg |
| cas | 59820-91-6 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 414.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid (CAS 59820-91-6) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid. InChIKey: DMPSJWYHZMDSPL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid |
| InChIKey | DMPSJWYHZMDSPL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)