cas: 877160-16-2 — see every product listed under this CAS number, including other names
7-Bromo-4,5-difluoro-1H-indole, 98% (CAS 877160-16-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g. Offered by: AmBeed, Chemat, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A905069-5g |
| cas | 877160-16-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8832.46 Pln | |
| AmBeed | 10g | 14665.42 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1475.60 Pln | |
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 2012.85 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-4,5-difluoro-1H-indole (CAS 877160-16-2) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 7-bromo-4,5-difluoro-1H-indole. InChIKey: PTDVLYWVIHHMMC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 7-bromo-4,5-difluoro-1H-indole |
| InChIKey | PTDVLYWVIHHMMC-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C=C(C(=C21)F)F)Br |
Computed by PubChem (NCBI)