CAS 1245651-19-7 appears in our catalog under these names: 4-(Bromomethyl)-2,5-difluorobenzonitrile, 95%, 4-(Bromomethyl)-2,5-difluorobenzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(bromomethyl)-2,5-difluorobenzonitrile (CAS 1245651-19-7) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 4-(bromomethyl)-2,5-difluorobenzonitrile. InChIKey: ZYBADXNEYMARJT-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 4-(bromomethyl)-2,5-difluorobenzonitrile |
| InChIKey | ZYBADXNEYMARJT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C#N)F)CBr |
Computed by PubChem (NCBI)