CAS 877160-16-2 appears in our catalog under these names: 7-Bromo-4,5-difluoro-1H-indole, 98%, 7-bromo-4,5-difluoro-1H-indole, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
7-bromo-4,5-difluoro-1H-indole (CAS 877160-16-2) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 7-bromo-4,5-difluoro-1H-indole. InChIKey: PTDVLYWVIHHMMC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 7-bromo-4,5-difluoro-1H-indole |
| InChIKey | PTDVLYWVIHHMMC-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C=C(C(=C21)F)F)Br |
Computed by PubChem (NCBI)