CAS 1381878-59-6 appears in our catalog under these names: 4-Bromo-5,7-difluoro-1h-indole, 95%, 4–Bromo–5,7–difluoro–1H–indole, 4-Bromo-5,7-difluoro-1H-indole, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 10g, 1g.
4-bromo-5,7-difluoro-1H-indole (CAS 1381878-59-6) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 4-bromo-5,7-difluoro-1H-indole. InChIKey: UJXYLPBQFUZOSP-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 4-bromo-5,7-difluoro-1H-indole |
| InChIKey | UJXYLPBQFUZOSP-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=C(C=C2F)F)Br |
Computed by PubChem (NCBI)