CAS 1261614-10-1 is the registry number for 3-Bromo-5-(difluoromethyl)benzonitrile, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
3-bromo-5-(difluoromethyl)benzonitrile (CAS 1261614-10-1) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 3-bromo-5-(difluoromethyl)benzonitrile. InChIKey: SJEOHZWKAWBOLP-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 3-bromo-5-(difluoromethyl)benzonitrile |
| InChIKey | SJEOHZWKAWBOLP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)F)Br)C#N |
Computed by PubChem (NCBI)