CAS 1251459-54-7 is the registry number for 5–(Bromomethyl)–2,3–difluorobenzonitrile. Offered by: GLPBio. Available pack sizes: 100mg.
5-(bromomethyl)-2,3-difluorobenzonitrile (CAS 1251459-54-7) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 5-(bromomethyl)-2,3-difluorobenzonitrile. InChIKey: PFXVIDCUMDORKN-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 5-(bromomethyl)-2,3-difluorobenzonitrile |
| InChIKey | PFXVIDCUMDORKN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)F)F)CBr |
Computed by PubChem (NCBI)