Products 1781212-27-8
CAS 1781212-27-8 appears in our catalog under these names: 2-(2-Bromo-3,4-difluorophenyl)acetonitrile, 98%, 2-Bromo-3,4-difluorophenylacetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(2-bromo-3,4-difluorophenyl)acetonitrile (CAS 1781212-27-8) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 2-(2-bromo-3,4-difluorophenyl)acetonitrile. InChIKey: IVMYDJVGZNHDRZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2-(2-bromo-3,4-difluorophenyl)acetonitrile |
| InChIKey | IVMYDJVGZNHDRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC#N)Br)F)F |
Computed by PubChem (NCBI)