CAS 1159186-98-7 is the registry number for 2-(3-Bromo-2,4-difluorophenyl)acetonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2-(3-bromo-2,4-difluorophenyl)acetonitrile (CAS 1159186-98-7) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 2-(3-bromo-2,4-difluorophenyl)acetonitrile. InChIKey: ITACQBHAMKMRPI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2-(3-bromo-2,4-difluorophenyl)acetonitrile |
| InChIKey | ITACQBHAMKMRPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC#N)F)Br)F |
Computed by PubChem (NCBI)