CAS 148172-45-6 is the registry number for 2-(4-Bromophenyl)-2,2-difluoroacetonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-bromophenyl)-2,2-difluoroacetonitrile (CAS 148172-45-6) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 2-(4-bromophenyl)-2,2-difluoroacetonitrile. InChIKey: FRSGKCUCZONIBL-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2,2-difluoroacetonitrile |
| InChIKey | FRSGKCUCZONIBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)(F)F)Br |
Computed by PubChem (NCBI)