cas: 1042973-67-0 — see every product listed under this CAS number, including other names
8-Amino-6-chloro-4h-benzo[1,4]oxazin-3-one, 98%, 98% (CAS 1042973-67-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HABT-100mg |
| cas | 1042973-67-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 597.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-amino-6-chloro-4H-1,4-benzoxazin-3-one (CAS 1042973-67-0) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 8-amino-6-chloro-4H-1,4-benzoxazin-3-one. InChIKey: LFQDPHSIICCBLE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 8-amino-6-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | LFQDPHSIICCBLE-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=CC(=C2O1)N)Cl |
Computed by PubChem (NCBI)