cas: 1578245-95-0 — see every product listed under this CAS number, including other names
8-CHLORO-2-(METHYLTHIO)PYRIDO[3,4-D]PYRIMIDINE, 97% (CAS 1578245-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F499242-100MG |
| cas | 1578245-95-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1112.13 Pln | |
| Fluorochem | 250mg | 1919.13 Pln | |
| Fluorochem | 1g | 5110.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine (CAS 1578245-95-0) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine. InChIKey: QMICGHGYKZQSQO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 8-chloro-2-methylsulfanylpyrido[3,4-d]pyrimidine |
| InChIKey | QMICGHGYKZQSQO-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C=CN=C(C2=N1)Cl |
Computed by PubChem (NCBI)