CAS 10210-28-3 appears in our catalog under these names: Anthracene-2,3-dicarboxylic acid, 97%, 97%, Anthracene-2,3-dicarboxylic acid, 97%, Anthracene-2,3-dicarboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 500mg.
Anthracene-2,3-dicarboxylic acid (CAS 10210-28-3) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: anthracene-2,3-dicarboxylic acid. InChIKey: GQKVCZAPFYNZHX-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | anthracene-2,3-dicarboxylic acid |
| InChIKey | GQKVCZAPFYNZHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C(C(=CC3=CC2=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)