CAS 4281-21-4 is the registry number for 3,3′-Biphthalide. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-oxo-1H-2-benzofuran-1-yl)-3H-2-benzofuran-1-one (CAS 4281-21-4) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 3-(3-oxo-1H-2-benzofuran-1-yl)-3H-2-benzofuran-1-one. InChIKey: MEGDIXZGVAJMRG-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 3-(3-oxo-1H-2-benzofuran-1-yl)-3H-2-benzofuran-1-one |
| InChIKey | MEGDIXZGVAJMRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(OC2=O)C3C4=CC=CC=C4C(=O)O3 |
Computed by PubChem (NCBI)