CAS 150443-85-9 appears in our catalog under these names: Biphenyl-3,3',5,5'-tetracarbaldehyde, 95%, (1,1'–Biphenyl)–3,3',5,5'–tetracarbaldehyde, [1,1'-Biphenyl]-3,3',5,5'-tetracarbaldehyde, 98%, 98%, [1,1'-Biphenyl]-3,3',5,5'-tetracarbaldehyde, 95%, [1,1'-Biphenyl]-3,3',5,5'-tetracarbaldehyde, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 500mg, 100mg, 25g.
5-(3,5-diformylphenyl)benzene-1,3-dicarbaldehyde (CAS 150443-85-9) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 5-(3,5-diformylphenyl)benzene-1,3-dicarbaldehyde. InChIKey: NAAGEIPGMZPBFY-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 5-(3,5-diformylphenyl)benzene-1,3-dicarbaldehyde |
| InChIKey | NAAGEIPGMZPBFY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C=O)C2=CC(=CC(=C2)C=O)C=O)C=O |
Computed by PubChem (NCBI)