CAS 138308-89-1 appears in our catalog under these names: Anthracene-2,6-dicarboxylic acid, 2,6–Anthracene dicarboxylic acid, Anthracene-2,6-dicarboxylic acid, 98%, 98%, Anthracene-2,6-dicarboxylic acid, 98%. Offered by: TRC, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 50mg, 500mg, 25mg.
Anthracene-2,6-dicarboxylic acid (CAS 138308-89-1) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: anthracene-2,6-dicarboxylic acid. InChIKey: XAAYMWLCUICVSL-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | anthracene-2,6-dicarboxylic acid |
| InChIKey | XAAYMWLCUICVSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)