Products 37617-98-4
CAS 37617-98-4 appears in our catalog under these names: 1-Oxo-4-phenyl-1h-isochromene-3-carboxylic acid, 95%, 1-Oxo-4-phenyl-1H-isochromene-3-carboxylic acid 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-oxo-4-phenylisochromene-3-carboxylic acid (CAS 37617-98-4) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 1-oxo-4-phenylisochromene-3-carboxylic acid. InChIKey: ZYYZSIFSEWJZOO-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 1-oxo-4-phenylisochromene-3-carboxylic acid |
| InChIKey | ZYYZSIFSEWJZOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=O)C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)