CAS 82074-09-7 is the registry number for 2,3-Dihydroanthra[1,2-b][1,4]dioxine-7,12-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydronaphtho[2,3-h][1,4]benzodioxine-7,12-dione (CAS 82074-09-7) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 2,3-dihydronaphtho[2,3-h][1,4]benzodioxine-7,12-dione. InChIKey: JPNRAFKCDBJGRS-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2,3-dihydronaphtho[2,3-h][1,4]benzodioxine-7,12-dione |
| InChIKey | JPNRAFKCDBJGRS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC3=C2C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)