CAS 73016-08-7 appears in our catalog under these names: Anthracene–9,10–dicarboxylic acid, 9,10-ANTHRACENEDICARBOXYLIC ACID, 95%, Anthracene-9,10-dicarboxylic acid, 98%, 98%, Anthracene-9,10-dicarboxylic acid, 97%, 9,10-Anthracenedicarboxylic acid, 98%. Offered by: GLPBio, Sigma-Aldrich, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 500MG, 10g, 5g, 25g.
Anthracene-9,10-dicarboxylic acid (CAS 73016-08-7) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: anthracene-9,10-dicarboxylic acid. InChIKey: FDFGHPKPHFUHBP-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | anthracene-9,10-dicarboxylic acid |
| InChIKey | FDFGHPKPHFUHBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)