Products 773872-42-7
CAS 773872-42-7 appears in our catalog under these names: 2-Benzoyl-1-benzofuran-5-carboxylic acid, 95%, 2-Benzoylbenzofuran-5-carboxylic acid, 97%, 2-benzoyl-1-benzofuran-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2-benzoyl-1-benzofuran-5-carboxylic acid (CAS 773872-42-7) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 2-benzoyl-1-benzofuran-5-carboxylic acid. InChIKey: INBYLGRPQWXPQY-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2-benzoyl-1-benzofuran-5-carboxylic acid |
| InChIKey | INBYLGRPQWXPQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(O2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)