CAS 915978-19-7 is the registry number for [1,1'-Biphenyl]-3,3',4,4'-tetracarbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-diformylphenyl)phthalaldehyde (CAS 915978-19-7) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 4-(3,4-diformylphenyl)phthalaldehyde. InChIKey: NIBWEPNXTOWAHK-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-(3,4-diformylphenyl)phthalaldehyde |
| InChIKey | NIBWEPNXTOWAHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)C=O)C=O)C=O)C=O |
Computed by PubChem (NCBI)