cas: 205445-52-9 — see every product listed under this CAS number, including other names
BOC-3,5-difluoro-L-phenylalanine, 95% (CAS 205445-52-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F095472-1G |
| cas | 205445-52-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 560.24 Pln | |
| Fluorochem | 10g | 1008.00 Pln | |
| Fluorochem | 25g | 2064.92 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 205445-52-9) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CZBNUDVCRKSYDG-NSHDSACASA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CZBNUDVCRKSYDG-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)