cas: 2483-49-0 — see every product listed under this CAS number, including other names
BOC-ALA-ONP, 98% (CAS 2483-49-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F475265-1G |
| cas | 2483-49-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 25g | 1268.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 2483-49-0) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: SUHFNHHZORGDFI-VIFPVBQESA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | SUHFNHHZORGDFI-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)