BOC-Tranexamic acid 97%
cas: 27687-14-5 — see every product listed under this CAS number, including other names
BOC-Tranexamic acid 97% (CAS 27687-14-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100805-500g |
| cas | 27687-14-5 |
| size | 500g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 4720.25 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1232.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100805 |
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid (CAS 27687-14-5) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid. InChIKey: AZEKNJGFCSHZID-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | AZEKNJGFCSHZID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1r,4r)-4-({[(tert-butoxy)carbonyl]amino}methyl)cyclohexane-1-carboxylic acid, (1r,4r)-4-((((Tert-butoxy)carbonyl)amino)methyl)cyclohexane-1-carboxylic acid, Boc-4-Amc-OH, BOC-TRANEXAMIC ACID, 4-(((tert-Butoxycarbonyl)amino)methyl)cyclohexanecarboxylic acid, trans-4-(tert-Butoxycarbonylaminomethyl)cyclohexanecarboxylic Acid, cis-(1,1-Dimethylethoxy)carbonyl Tranexamic Acid, 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic Acid, trans-4-(((tert-Butoxycarbonyl)amino)methyl)cyclohexanecarboxylic acid, trans-4-N-Boc-Aminomethyl-cyclohexanecarboxylic acid