Benzenepropanoic acid, β-amino-4-bromo-, hydrochloride (1:1), (βS)-, 95%, 95%
cas: 930769-56-5 — see every product listed under this CAS number, including other names
Benzenepropanoic acid, β-amino-4-bromo-, hydrochloride (1:1), (βS)-, 95%, 95% (CAS 930769-56-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AA7M-100mg |
| cas | 930769-56-5 |
| size | 100mg |
| availability | 1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 789.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride (CAS 930769-56-5) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (3S)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride. InChIKey: UDMBAXSJPLSJGM-QRPNPIFTSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | UDMBAXSJPLSJGM-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-amino-3-(4-bromophenyl)propanoic acid hydrochloride, (S)-3-Amino-3-(4-bromophenyl)propanoic acid hydrochloride, (S)-3-Amino-3-(4-bromophenyl)propanoic acid HCl, (3S)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride, L-3-Amino-3-(4-bromo)propanoic acid hydrochloride, (S)-3-Amino-3-(4-Bromophenyl)Propanoic Acid Hydrochloride Salt, (S)-3-Amino-3-(4-bromo)propanoic acid hydrochloride, (S)-3-Amino-3-(4-bromophenyl)propanoicacidhydrochloride