Products 865139-46-4
CAS 865139-46-4 is the registry number for Ethyl 4-amino-3-bromobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 4-amino-3-bromobenzoate;hydrochloride (CAS 865139-46-4) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: ethyl 4-amino-3-bromobenzoate;hydrochloride. InChIKey: DZMRGDCIGBAECK-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | ethyl 4-amino-3-bromobenzoate;hydrochloride |
| InChIKey | DZMRGDCIGBAECK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)Br.Cl |
Computed by PubChem (NCBI)